cas: 160060-21-9 — see every product listed under this CAS number, including other names
Ethyl 2-acetylthiazole-4-carboxylate, 98%, 98% (CAS 160060-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RN1-100mg |
| cas | 160060-21-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 1994.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-acetyl-1,3-thiazole-4-carboxylate (CAS 160060-21-9) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: ethyl 2-acetyl-1,3-thiazole-4-carboxylate. InChIKey: WBRRJINEWZWGLJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | ethyl 2-acetyl-1,3-thiazole-4-carboxylate |
| InChIKey | WBRRJINEWZWGLJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C(=O)C |
Computed by PubChem (NCBI)