cas: 306934-99-6 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate 95+% (CAS 306934-99-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151459-250mg |
| cas | 306934-99-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 843.19 Pln | |
| Ambeed | 10g | 1427.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A151459 |
Ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate (CAS 306934-99-6) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate. InChIKey: SEWFWRCESBYGFS-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate |
| InChIKey | SEWFWRCESBYGFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)