cas: 306934-99-6 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate, 98%, 98% (CAS 306934-99-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141U1-100mg |
| cas | 306934-99-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 573.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate (CAS 306934-99-6) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate. InChIKey: SEWFWRCESBYGFS-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate |
| InChIKey | SEWFWRCESBYGFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)