cas: 15854-08-7 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4-(4-methylphenyl)thiophene-3-carboxylate (CAS 15854-08-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 2mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Q0U-250mg |
| cas | 15854-08-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 2109.20 Pln | |
| Chemat | 2mg | 174.80 Pln | |
| Chemat | 5mg | 232.40 Pln |
| delivery time | 3 weeks |
|---|
Ethyl 2-amino-4-(4-methylphenyl)thiophene-3-carboxylate (CAS 15854-08-7) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: ethyl 2-amino-4-(4-methylphenyl)thiophene-3-carboxylate. InChIKey: GOQSMGNEJVWZIG-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-methylphenyl)thiophene-3-carboxylate |
| InChIKey | GOQSMGNEJVWZIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)C)N |
Computed by PubChem (NCBI)