CAS 852400-09-0 appears in our catalog under these names: 2-Benzothiazol-2-yl-cyclohexanecarboxylic acid, 95%, 2-(Benzo(d)thiazol-2-yl)cyclohexanecarboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylic acid (CAS 852400-09-0) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylic acid. InChIKey: UYUNBKRWYMGAKX-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylic acid |
| InChIKey | UYUNBKRWYMGAKX-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C2=NC3=CC=CC=C3S2)C(=O)O |
Computed by PubChem (NCBI)