CAS 77198-99-3 appears in our catalog under these names: N-(2-Phenylethyl)benzenesulfonamide, 95%, N-(2-Phenylethyl)benzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
N-(2-phenylethyl)benzenesulfonamide (CAS 77198-99-3) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: N-(2-phenylethyl)benzenesulfonamide. InChIKey: ASBWJERTCCTIMI-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | N-(2-phenylethyl)benzenesulfonamide |
| InChIKey | ASBWJERTCCTIMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)