cas: 268568-11-2 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-iodobenzoate, 98%, 98% (CAS 268568-11-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q4B-5g |
| cas | 268568-11-2 |
| size | 5g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 537.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-5-iodobenzoate (CAS 268568-11-2) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: ethyl 2-amino-5-iodobenzoate. InChIKey: FPCLHSGOJPEKKE-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | ethyl 2-amino-5-iodobenzoate |
| InChIKey | FPCLHSGOJPEKKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)I)N |
Computed by PubChem (NCBI)