CAS 62875-84-7 appears in our catalog under these names: Ethyl 4-amino-3-iodobenzoate, 95%, Ethyl 4–amino–3–iodobenzoate, Ethyl 4-amino-3-iodobenzoate 98+%, Ethyl 4-amino-3-iodobenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100mg, 250mg.
Ethyl 4-amino-3-iodobenzoate (CAS 62875-84-7) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: ethyl 4-amino-3-iodobenzoate. InChIKey: ICFCBYVKPRHTPR-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | ethyl 4-amino-3-iodobenzoate |
| InChIKey | ICFCBYVKPRHTPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)I |
Computed by PubChem (NCBI)