cas: 4815-34-3 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-phenylthiophene-3-carboxylate 98% (CAS 4815-34-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345244-250mg |
| cas | 4815-34-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 2550.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A345244 |
Ethyl 2-amino-5-phenylthiophene-3-carboxylate (CAS 4815-34-3) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-amino-5-phenylthiophene-3-carboxylate. InChIKey: WIVNPGXPJBBZQH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | ethyl 2-amino-5-phenylthiophene-3-carboxylate |
| InChIKey | WIVNPGXPJBBZQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)