cas: 96334-44-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-7-oxo-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate 98% (CAS 96334-44-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146428-5g |
| cas | 96334-44-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A146428 |
Ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (CAS 96334-44-0) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate. InChIKey: KHNVFGZAADIYSH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| InChIKey | KHNVFGZAADIYSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCCC2=O)N |
Computed by PubChem (NCBI)