cas: 1547445-11-3 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate, 98% (CAS 1547445-11-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869972-100MG |
| cas | 1547445-11-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1013.20 Pln | |
| Fluorochem | 5g | 3881.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-bromo-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate (CAS 1547445-11-3) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: ethyl 2-bromo-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate. InChIKey: SIKMIRQRUUUIKQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | ethyl 2-bromo-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate |
| InChIKey | SIKMIRQRUUUIKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)SC(=N2)Br |
Computed by PubChem (NCBI)