CAS 1046816-12-9 is the registry number for 6-Bromo-2-(methylsulfonyl)-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline (CAS 1046816-12-9) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: 6-bromo-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline. InChIKey: DOPOZSRPPBTBDG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 6-bromo-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline |
| InChIKey | DOPOZSRPPBTBDG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C(C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)