CAS 1016860-62-0 appears in our catalog under these names: N-(4-Bromo-3-methylphenyl)-1,3-propanesultam, 97%, N-(4-Bromo-3-methylphenyl)-1,3-propanesultam. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g.
2-(4-bromo-3-methylphenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1016860-62-0) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: ZVJDZMGIZMQYIC-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | ZVJDZMGIZMQYIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2CCCS2(=O)=O)Br |
Computed by PubChem (NCBI)