CAS 1226343-78-7 is the registry number for N-(3-Bromo-4-methylphenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromo-4-methylphenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1226343-78-7) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: 2-(3-bromo-4-methylphenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: KFCOLWWSHFHOLX-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(3-bromo-4-methylphenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | KFCOLWWSHFHOLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCCS2(=O)=O)Br |
Computed by PubChem (NCBI)