Products 1157455-39-4
CAS 1157455-39-4 appears in our catalog under these names: 2-(5-Bromo-2-methylphenyl)-1,2-thiazolidine-1,1-dione, 95%, 2-(5-Bromo-2-methylphenyl)-1,2-thiazolidine-1,1-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(5-bromo-2-methylphenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1157455-39-4) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: 2-(5-bromo-2-methylphenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: IAMBIPANMJYCMV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(5-bromo-2-methylphenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | IAMBIPANMJYCMV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)N2CCCS2(=O)=O |
Computed by PubChem (NCBI)