CAS 136584-14-0 is the registry number for 1,2,3,4-Tetrahydro-3-oxo-2-quinoxalineacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)acetic acid (CAS 136584-14-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)acetic acid. InChIKey: UCNFCRXGPQHQBE-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)acetic acid |
| InChIKey | UCNFCRXGPQHQBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)