CAS 927804-72-6 is the registry number for Ethyl 3-aminofuro[2,3-c]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 3-aminofuro[2,3-c]pyridine-2-carboxylate (CAS 927804-72-6) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 3-aminofuro[2,3-c]pyridine-2-carboxylate. InChIKey: HJTNMZXLOONCHT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | ethyl 3-aminofuro[2,3-c]pyridine-2-carboxylate |
| InChIKey | HJTNMZXLOONCHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)C=NC=C2)N |
Computed by PubChem (NCBI)