cas: 59382-60-4 — see every product listed under this CAS number, including other names
Ethyl 2-methyl-3-nitrobenzoate, 97%, 97% (CAS 59382-60-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAJR-25g |
| cas | 59382-60-4 |
| size | 25g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 513.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-methyl-3-nitrobenzoate (CAS 59382-60-4) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: ethyl 2-methyl-3-nitrobenzoate. InChIKey: XINYBVBBEWUEPZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | ethyl 2-methyl-3-nitrobenzoate |
| InChIKey | XINYBVBBEWUEPZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)