cas: 192817-79-1 — see every product listed under this CAS number, including other names
Ethyl 2-morpholinobenzoate, 95+% (CAS 192817-79-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A223956-5g |
| cas | 192817-79-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15134.14 Pln | |
| AmBeed | 10g | 18298.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2-morpholin-4-ylbenzoate (CAS 192817-79-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 2-morpholin-4-ylbenzoate. InChIKey: UIVDSGDHUXOYDW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | ethyl 2-morpholin-4-ylbenzoate |
| InChIKey | UIVDSGDHUXOYDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1N2CCOCC2 |
Computed by PubChem (NCBI)