cas: 192817-79-1 — see every product listed under this CAS number, including other names
Ethyl 2-morpholinobenzoate, 97% (CAS 192817-79-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC24323CB |
| cas | 192817-79-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 201.60 Pln | |
| Thermo Scientific | 1g | 554.90 Pln | |
| Thermo Scientific | 10g | 2769.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Ethyl 2-morpholin-4-ylbenzoate (CAS 192817-79-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 2-morpholin-4-ylbenzoate. InChIKey: UIVDSGDHUXOYDW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | ethyl 2-morpholin-4-ylbenzoate |
| InChIKey | UIVDSGDHUXOYDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1N2CCOCC2 |
Computed by PubChem (NCBI)