CAS 192817-79-1 appears in our catalog under these names: 2-Morpholin-4-yl-benzoic acid ethyl ester, 95%, Ethyl 2-morpholinobenzoate, 95+%, 2–Morpholin–4–Yl–Benzoic Acid Ethyl Ester, Ethyl 2-morpholinobenzoate, 97% . Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
Ethyl 2-morpholin-4-ylbenzoate (CAS 192817-79-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 2-morpholin-4-ylbenzoate. InChIKey: UIVDSGDHUXOYDW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | ethyl 2-morpholin-4-ylbenzoate |
| InChIKey | UIVDSGDHUXOYDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1N2CCOCC2 |
Computed by PubChem (NCBI)