cas: 116548-02-8 — see every product listed under this CAS number, including other names
Ethyl 2-oxo-6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxylate, 95%, 95% (CAS 116548-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CRJ-100mg |
| cas | 116548-02-8 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 10g | 1446.80 Pln | |
| Chemat | 25g | 2829.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate (CAS 116548-02-8) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: ethyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate. InChIKey: MKNWSULTPQRNKN-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | ethyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| InChIKey | MKNWSULTPQRNKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(NC1=O)C(F)(F)F |
Computed by PubChem (NCBI)