cas: 130912-54-8 — see every product listed under this CAS number, including other names
Ethyl 3,3-dimethyl-4-nitrobutanoate, 99.69% (CAS 130912-54-8) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 100 mg, 500 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-41315-1 g |
| cas | 130912-54-8 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 2469.86 Pln | |
| MedChemExpress | 5 g | 5158.74 Pln | |
| MedChemExpress | 100 mg | 649.42 Pln | |
| MedChemExpress | 500 mg | 1680.38 Pln | |
| MedChemExpress | 250 mg | 1174.19 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.69% |
Ethyl 3,3-dimethyl-4-nitrobutanoate (CAS 130912-54-8) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: ethyl 3,3-dimethyl-4-nitrobutanoate. InChIKey: UXVSMZJRKNDLII-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | ethyl 3,3-dimethyl-4-nitrobutanoate |
| InChIKey | UXVSMZJRKNDLII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C)C[N+](=O)[O-] |
Computed by PubChem (NCBI)