cas: 130912-54-8 — see every product listed under this CAS number, including other names
Ethyl 3,3-Dimethyl-4-Nitrobutanoate, 98%, 98% (CAS 130912-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110CLL-100mg |
| cas | 130912-54-8 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 2190.80 Pln | |
| Chemat | 5g | 4624.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3,3-dimethyl-4-nitrobutanoate (CAS 130912-54-8) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: ethyl 3,3-dimethyl-4-nitrobutanoate. InChIKey: UXVSMZJRKNDLII-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | ethyl 3,3-dimethyl-4-nitrobutanoate |
| InChIKey | UXVSMZJRKNDLII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C)C[N+](=O)[O-] |
Computed by PubChem (NCBI)