cas: 1806321-00-5 — see every product listed under this CAS number, including other names
Ethyl 3,5-difluoro-4-methylbenzoate, 97% (CAS 1806321-00-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A914039-10g |
| cas | 1806321-00-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16996.00 Pln | |
| AmBeed | 25g | 33329.59 Pln | |
| AmBeed | 5g | 10056.34 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 3,5-difluoro-4-methylbenzoate (CAS 1806321-00-5) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 3,5-difluoro-4-methylbenzoate. InChIKey: BQTYVGJKGMPCSY-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 3,5-difluoro-4-methylbenzoate |
| InChIKey | BQTYVGJKGMPCSY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)F)C)F |
Computed by PubChem (NCBI)