cas: 143982-54-1 — see every product listed under this CAS number, including other names
Ethyl 3-Bromoimidazo[1,2-a]pyridine-2-carboxylate, 97% (CAS 143982-54-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067115-1G |
| cas | 143982-54-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 721.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 143982-54-1) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: MPILHKPXTMEIMG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | MPILHKPXTMEIMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C=CC=CC2=N1)Br |
Computed by PubChem (NCBI)