CAS 1456070-27-1 is the registry number for Ethyl 5-bromoindazole-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Ethyl 5-bromoindazole-1-carboxylate (CAS 1456070-27-1) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromoindazole-1-carboxylate. InChIKey: VUEQZUIALMZBNQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromoindazole-1-carboxylate |
| InChIKey | VUEQZUIALMZBNQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=C(C=C(C=C2)Br)C=N1 |
Computed by PubChem (NCBI)