cas: 325803-29-0 — see every product listed under this CAS number, including other names
Ethyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 97%, 97% (CAS 325803-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I77F-250mg |
| cas | 325803-29-0 |
| size | 250mg |
| availability | 70g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1413.20 Pln | |
| Chemat | 1g | 3429.20 Pln | |
| Chemat | 5g | 10149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 325803-29-0) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GEFYSNMLNDGKHT-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GEFYSNMLNDGKHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)