Products 325803-29-0
CAS 325803-29-0 appears in our catalog under these names: Ethyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 98%, Ethyl 3–amino–3–(4–chlorophenyl)propanoate hydrochloride, Ethyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 97%, 97%, Ethyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 325803-29-0) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GEFYSNMLNDGKHT-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GEFYSNMLNDGKHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)