cas: 325803-29-0 — see every product listed under this CAS number, including other names
Ethyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 97% (CAS 325803-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689600-1G |
| cas | 325803-29-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 706.02 Pln | |
| Fluorochem | 5g | 2288.80 Pln | |
| Fluorochem | 25g | 8010.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 325803-29-0) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GEFYSNMLNDGKHT-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl 3-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GEFYSNMLNDGKHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)