Products 100129-68-8

CAS 100129-68-8 is the registry number for 2-[(2-Chloroethyl)amino]ethyl benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-chloroethylamino)ethyl benzoate;hydrochloride (CAS 100129-68-8) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: 2-(2-chloroethylamino)ethyl benzoate;hydrochloride. InChIKey: GTYWFUWYPFQLKF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Cl2NO2
Molecular weight264.14 g/mol
IUPAC name2-(2-chloroethylamino)ethyl benzoate;hydrochloride
InChIKeyGTYWFUWYPFQLKF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)OCCNCCCl.Cl

Computed by PubChem (NCBI)