CAS 875001-84-6 is the registry number for 2-((2,4-Dichlorobenzyl)amino)-2-methylpropane-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,4-dichlorophenyl)methylamino]-2-methylpropane-1,3-diol (CAS 875001-84-6) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylamino]-2-methylpropane-1,3-diol. InChIKey: IPTQQFKHDVTKBT-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylamino]-2-methylpropane-1,3-diol |
| InChIKey | IPTQQFKHDVTKBT-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)NCC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)