Products 1311317-03-9
CAS 1311317-03-9 appears in our catalog under these names: 2-{((4-chlorophenyl)methyl)(ethyl)amino}acetic acid hydrochloride, 95%, 2-{((4-Chlorophenyl)methyl)(ethyl)amino}acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[(4-chlorophenyl)methyl-ethylamino]acetic acid;hydrochloride (CAS 1311317-03-9) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl-ethylamino]acetic acid;hydrochloride. InChIKey: XJKYCOKACZDKPH-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl-ethylamino]acetic acid;hydrochloride |
| InChIKey | XJKYCOKACZDKPH-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=C(C=C1)Cl)CC(=O)O.Cl |
Computed by PubChem (NCBI)