cas: 1352206-56-4 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-2,6-dimethoxybenzoate, ≥95%, ≥95% (CAS 1352206-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120ETT-1g |
| cas | 1352206-56-4 |
| size | 1g |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3030.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-bromo-2,6-dimethoxybenzoate (CAS 1352206-56-4) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: ethyl 3-bromo-2,6-dimethoxybenzoate. InChIKey: MIKNVTLIXOHBRP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | ethyl 3-bromo-2,6-dimethoxybenzoate |
| InChIKey | MIKNVTLIXOHBRP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1OC)Br)OC |
Computed by PubChem (NCBI)