cas: 1352206-56-4 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-2,6-dimethoxybenzoate (CAS 1352206-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630871-1G |
| cas | 1352206-56-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3923.64 Pln | |
| Fluorochem | 5g | 11639.67 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 3-bromo-2,6-dimethoxybenzoate (CAS 1352206-56-4) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: ethyl 3-bromo-2,6-dimethoxybenzoate. InChIKey: MIKNVTLIXOHBRP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | ethyl 3-bromo-2,6-dimethoxybenzoate |
| InChIKey | MIKNVTLIXOHBRP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1OC)Br)OC |
Computed by PubChem (NCBI)