CAS 386267-31-8 appears in our catalog under these names: Ethyl 3-bromo-4-iodobenzoate, 98%, 98%, Ethyl 3-bromo-4-iodobenzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Ethyl 3-bromo-4-iodobenzoate (CAS 386267-31-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 3-bromo-4-iodobenzoate. InChIKey: LNDNOULYVIEUBZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 3-bromo-4-iodobenzoate |
| InChIKey | LNDNOULYVIEUBZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)I)Br |
Computed by PubChem (NCBI)