cas: 16357-41-8 — see every product listed under this CAS number, including other names
Ethyl 3-chloro-4-hydroxybenzoate 95% (CAS 16357-41-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A594385-250mg |
| cas | 16357-41-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2033.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A594385 |
Ethyl 3-chloro-4-hydroxybenzoate (CAS 16357-41-8) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: ethyl 3-chloro-4-hydroxybenzoate. InChIKey: QBOWIPYEPOVPGR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | ethyl 3-chloro-4-hydroxybenzoate |
| InChIKey | QBOWIPYEPOVPGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)O)Cl |
Computed by PubChem (NCBI)