cas: 1125674-06-7 — see every product listed under this CAS number, including other names
Ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate 97% (CAS 1125674-06-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158887-50mg |
| cas | 1125674-06-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 175.69 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1416.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A158887 |
Ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate (CAS 1125674-06-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate. InChIKey: CLTZMASYQJXYBR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate |
| InChIKey | CLTZMASYQJXYBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)N=CC=C2)C |
Computed by PubChem (NCBI)