cas: 1125674-06-7 — see every product listed under this CAS number, including other names
Ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate, 97%, 97% (CAS 1125674-06-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCEF-50mg |
| cas | 1125674-06-7 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate (CAS 1125674-06-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate. InChIKey: CLTZMASYQJXYBR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 3-methylfuro[2,3-b]pyridine-2-carboxylate |
| InChIKey | CLTZMASYQJXYBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)N=CC=C2)C |
Computed by PubChem (NCBI)