cas: 1080026-94-3 — see every product listed under this CAS number, including other names
Ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate 95% (CAS 1080026-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163978-100mg |
| cas | 1080026-94-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 3446.44 Pln | |
| Ambeed | 10g | 5465.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A163978 |
Ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate (CAS 1080026-94-3) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate. InChIKey: HLYOOHYZCZJODO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate |
| InChIKey | HLYOOHYZCZJODO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCNC2 |
Computed by PubChem (NCBI)