cas: 1080026-94-3 — see every product listed under this CAS number, including other names
Ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate, 95%, 95% (CAS 1080026-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118DOP-100mg |
| cas | 1080026-94-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 870.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate (CAS 1080026-94-3) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate. InChIKey: HLYOOHYZCZJODO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | ethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylate |
| InChIKey | HLYOOHYZCZJODO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCNC2 |
Computed by PubChem (NCBI)