Products 1024038-40-1

CAS 1024038-40-1 is the registry number for Ethyl 1-(piperidin-3-yl)cyclopropane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 1-piperidin-3-ylcyclopropane-1-carboxylate;hydrochloride (CAS 1024038-40-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl 1-piperidin-3-ylcyclopropane-1-carboxylate;hydrochloride. InChIKey: QBIRUUWIWMIXBY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO2
Molecular weight233.73 g/mol
IUPAC nameethyl 1-piperidin-3-ylcyclopropane-1-carboxylate;hydrochloride
InChIKeyQBIRUUWIWMIXBY-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC1)C2CCCNC2.Cl

Computed by PubChem (NCBI)