CAS 2578391-93-0 is the registry number for 2-(3,3,5,5-Tetramethylpiperidin-4-ylidene)acetic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,3,5,5-tetramethylpiperidin-4-ylidene)acetic acid;hydrochloride (CAS 2578391-93-0) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: 2-(3,3,5,5-tetramethylpiperidin-4-ylidene)acetic acid;hydrochloride. InChIKey: MFTWEQFVEVNUDK-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | 2-(3,3,5,5-tetramethylpiperidin-4-ylidene)acetic acid;hydrochloride |
| InChIKey | MFTWEQFVEVNUDK-UHFFFAOYSA-N |
| SMILES | CC1(CNCC(C1=CC(=O)O)(C)C)C.Cl |
Computed by PubChem (NCBI)