cas: 62875-84-7 — see every product listed under this CAS number, including other names
Ethyl 4-amino-3-iodobenzoate, 97%, 97% (CAS 62875-84-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EFUW-100mg |
| cas | 62875-84-7 |
| size | 100mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 870.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-amino-3-iodobenzoate (CAS 62875-84-7) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: ethyl 4-amino-3-iodobenzoate. InChIKey: ICFCBYVKPRHTPR-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | ethyl 4-amino-3-iodobenzoate |
| InChIKey | ICFCBYVKPRHTPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)I |
Computed by PubChem (NCBI)