cas: 1693851-34-1 — see every product listed under this CAS number, including other names
Ethyl 4-bromo-1-indanone-2-carboxylate, 95-<97% (CAS 1693851-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5842-95-97-1g |
| cas | 1693851-34-1 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3478.86 Pln | |
| Hoffman Fine Chemicals | 2,5g | 5858.60 Pln | |
| Hoffman Fine Chemicals | 5g | 9188.96 Pln | |
| Hoffman Fine Chemicals | 10g | 14516.26 Pln | |
| Hoffman Fine Chemicals | 25g | 28718.14 Pln | |
| Hoffman Fine Chemicals | 50g | 45765.50 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Ethyl 7-bromo-3-oxo-1,2-dihydroindene-2-carboxylate (CAS 1693851-34-1) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: ethyl 7-bromo-3-oxo-1,2-dihydroindene-2-carboxylate. InChIKey: NXMRMHFUBBKVMY-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | ethyl 7-bromo-3-oxo-1,2-dihydroindene-2-carboxylate |
| InChIKey | NXMRMHFUBBKVMY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C1=O)C=CC=C2Br |
Computed by PubChem (NCBI)