CAS 1620821-67-1 is the registry number for Methyl 4-(2-bromoacetyl)cubane-1-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g.
Methyl 4-(2-bromoacetyl)cubane-1-carboxylate (CAS 1620821-67-1) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: methyl 4-(2-bromoacetyl)cubane-1-carboxylate. InChIKey: ATUHPXAOEFATHB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | methyl 4-(2-bromoacetyl)cubane-1-carboxylate |
| InChIKey | ATUHPXAOEFATHB-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)CBr |
Computed by PubChem (NCBI)