CAS 10185-03-2 is the registry number for 3-(2-Bromoethyl)-7-hydroxy-4-methyl-coumarin. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
3-(2-bromoethyl)-7-hydroxy-4-methylchromen-2-one (CAS 10185-03-2) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: 3-(2-bromoethyl)-7-hydroxy-4-methylchromen-2-one. InChIKey: DGIJUQRAWXZSQC-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 3-(2-bromoethyl)-7-hydroxy-4-methylchromen-2-one |
| InChIKey | DGIJUQRAWXZSQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)O)CCBr |
Computed by PubChem (NCBI)