CAS 1263104-50-2 is the registry number for Methyl 7-bromo-1-oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-bromo-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate (CAS 1263104-50-2) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: methyl 7-bromo-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate. InChIKey: JMLZURIQVHOIEW-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | methyl 7-bromo-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate |
| InChIKey | JMLZURIQVHOIEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)