cas: 50476-72-7 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate 95% (CAS 50476-72-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A637925-50mg |
| cas | 50476-72-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 670.75 Pln | |
| Ambeed | 100mg | 876.56 Pln | |
| Ambeed | 250mg | 1421.69 Pln | |
| Ambeed | 1g | 2951.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A637925 |
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate (CAS 50476-72-7) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate. InChIKey: PJMVISKPSDWZFO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
| InChIKey | PJMVISKPSDWZFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=NN2 |
Computed by PubChem (NCBI)