cas: 1167056-15-6 — see every product listed under this CAS number, including other names
Ethyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate, 97%, 97% (CAS 1167056-15-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XQK-100mg |
| cas | 1167056-15-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 500mg | 1595.60 Pln | |
| Chemat | 1g | 2618.00 Pln | |
| Chemat | 5g | 7720.40 Pln | |
| Chemat | 10g | 12827.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate (CAS 1167056-15-6) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: JZSLHWOPNFSRLT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | JZSLHWOPNFSRLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=CN2N=C1)Cl |
Computed by PubChem (NCBI)